* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX115187-001 |
EnglishSynonyms: | WUXIAPPTEC WX115187-001 ; WUXIAPPTEC WX115187-005 ; WUXIAPPTEC WX115187-010 |
pro_mdlNumber: | MFCD17016656 |
pro_acceptors: | 7 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC[C@]2(CNCCN([C@H]2C1)C(=O)OCC1=CC=CC=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C27H35N3O4/c1-26(2,3)34-24(31)29-16-14-27(22-12-8-5-9-13-22)20-28-15-17-30(23(27)18-29)25(32)33-19-21-10-6-4-7-11-21/h4-13,23,28H,14-20H2,1-3H3/t23-,27-/m0/s1 |
InChiKey: | InChIKey=UZUXCLOYSNBDAZ-HOFKKMOUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.