* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX120145-001 |
| EnglishSynonyms: | WUXIAPPTEC WX120145-010 ; WUXIAPPTEC WX120145-005 ; WUXIAPPTEC WX120145-001 |
| pro_mdlNumber: | MFCD17016780 |
| pro_acceptors: | 8 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CC2CN(CC(C2)(C1)C(O)=O)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C21H28N2O6/c1-20(2,3)29-19(27)23-11-16-9-21(14-23,17(24)25)13-22(10-16)18(26)28-12-15-7-5-4-6-8-15/h4-8,16H,9-14H2,1-3H3,(H,24,25) |
| InChiKey: | InChIKey=NKUKLRKOGRAUAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.