* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX120158-001 |
EnglishSynonyms: | WUXIAPPTEC WX120158-001 ; WUXIAPPTEC WX120158-005 ; WUXIAPPTEC WX120158-010 |
pro_mdlNumber: | MFCD17016793 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | COC(=O)[C@@]12CC1C[C@H](C2)NC(=O)OC(C)(C)C |
InChi: | InChI=1S/C13H21NO4/c1-12(2,3)18-11(16)14-9-5-8-6-13(8,7-9)10(15)17-4/h8-9H,5-7H2,1-4H3,(H,14,16)/t8?,9-,13-/m1/s1 |
InChiKey: | InChIKey=NWMWNMSEJNVGEN-VPQWPZGESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.