* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX125063-001 |
| EnglishSynonyms: | WUXIAPPTEC WX125063-001 ; WUXIAPPTEC WX125063-005 ; WUXIAPPTEC WX125063-010 |
| pro_mdlNumber: | MFCD17016852 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | O=C(OCC1=CC=CC=C1)N1C2CCCC1C1=C(C2)NC=N1 |
| InChi: | InChI=1S/C17H19N3O2/c21-17(22-10-12-5-2-1-3-6-12)20-13-7-4-8-15(20)16-14(9-13)18-11-19-16/h1-3,5-6,11,13,15H,4,7-10H2,(H,18,19) |
| InChiKey: | InChIKey=NSEFNFRDDAWTNJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.