* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX135018-001 |
| EnglishSynonyms: | WUXIAPPTEC WX135018-005 ; WUXIAPPTEC WX135018-010 ; WUXIAPPTEC WX135018-001 |
| pro_mdlNumber: | MFCD17016879 |
| pro_acceptors: | 9 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)OC(=O)NC1=CN=C2N1C=CN1C(=CN=C21)C(O)=O |
| InChi: | InChI=1S/C14H15N5O4/c1-14(2,3)23-13(22)17-9-7-16-11-10-15-6-8(12(20)21)18(10)4-5-19(9)11/h4-7H,1-3H3,(H,17,22)(H,20,21) |
| InChiKey: | InChIKey=SLZRHPSASDVSTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.