* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX135038-001 |
EnglishSynonyms: | WUXIAPPTEC WX135038-005 ; WUXIAPPTEC WX135038-010 ; WUXIAPPTEC WX135038-001 |
pro_mdlNumber: | MFCD17016895 |
pro_acceptors: | 8 |
pro_donors: | 0 |
pro_smile: | CCOC(=O)C1=C2N=C(Cl)C3=C(CN(CC3)C(=O)OCC3=CC=CC=C3)N2C=N1 |
InChi: | InChI=1S/C20H19ClN4O4/c1-2-28-19(26)16-18-23-17(21)14-8-9-24(10-15(14)25(18)12-22-16)20(27)29-11-13-6-4-3-5-7-13/h3-7,12H,2,8-11H2,1H3 |
InChiKey: | InChIKey=NVJUWMVRNXGPDD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.