* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX145027-001 |
EnglishSynonyms: | WUXIAPPTEC WX145027-010 ; WUXIAPPTEC WX145027-005 ; WUXIAPPTEC WX145027-001 |
pro_mdlNumber: | MFCD17016925 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | BrC1=CN2C3=C(CNC(=O)C3)N=C2C=C1 |
InChi: | InChI=1S/C10H8BrN3O/c11-6-1-2-9-13-7-4-12-10(15)3-8(7)14(9)5-6/h1-2,5H,3-4H2,(H,12,15) |
InChiKey: | InChIKey=SBKHGPBDWQOAPK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.