* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX145031-001 |
EnglishSynonyms: | WUXIAPPTEC WX145031-005 ; WUXIAPPTEC WX145031-001 ; WUXIAPPTEC WX145031-010 |
pro_mdlNumber: | MFCD17016929 |
pro_acceptors: | 6 |
pro_donors: | 1 |
pro_smile: | CSC1=NC2=C(CCCN3C=NC(C(O)=O)=C23)C=N1 |
InChi: | InChI=1S/C12H12N4O2S/c1-19-12-13-5-7-3-2-4-16-6-14-9(11(17)18)10(16)8(7)15-12/h5-6H,2-4H2,1H3,(H,17,18) |
InChiKey: | InChIKey=GZAOPDQQJAQFEU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.