* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX145033-001 |
EnglishSynonyms: | WUXIAPPTEC WX145033-005 ; WUXIAPPTEC WX145033-001 ; WUXIAPPTEC WX145033-010 |
pro_mdlNumber: | MFCD17016931 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | BrC1=CC2=C(NCCC3=C2C=NN3)C=C1 |
InChi: | InChI=1S/C11H10BrN3/c12-7-1-2-10-8(5-7)9-6-14-15-11(9)3-4-13-10/h1-2,5-6,13H,3-4H2,(H,14,15) |
InChiKey: | InChIKey=WAMWFPACKQGBKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.