* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX145035-001 |
| EnglishSynonyms: | WUXIAPPTEC WX145035-005 ; WUXIAPPTEC WX145035-010 ; WUXIAPPTEC WX145035-001 |
| pro_mdlNumber: | MFCD17016933 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)C1=NC2=C(CNC3=C(C2)C=CC=C3)S1 |
| InChi: | InChI=1S/C14H14N2O2S/c1-2-18-14(17)13-16-11-7-9-5-3-4-6-10(9)15-8-12(11)19-13/h3-6,15H,2,7-8H2,1H3 |
| InChiKey: | InChIKey=UFMIQQWLMLAZLQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.