* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX145038-001 |
| EnglishSynonyms: | WUXIAPPTEC WX145038-001 ; WUXIAPPTEC WX145038-005 ; WUXIAPPTEC WX145038-010 |
| pro_mdlNumber: | MFCD17016935 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | COC(=O)C1=C2C=CC=CC2=C2CNC(=O)CCN12 |
| InChi: | InChI=1S/C14H14N2O3/c1-19-14(18)13-10-5-3-2-4-9(10)11-8-15-12(17)6-7-16(11)13/h2-5H,6-8H2,1H3,(H,15,17) |
| InChiKey: | InChIKey=VYVAKSYJUUKUFA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.