* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX145042-001 |
EnglishSynonyms: | WUXIAPPTEC WX145042-005 ; WUXIAPPTEC WX145042-001 ; WUXIAPPTEC WX145042-010 |
pro_mdlNumber: | MFCD17016939 |
pro_acceptors: | 4 |
pro_donors: | 3 |
pro_smile: | OC(=O)C1=CC2=C(CNC3=C(C2)C=CC=C3)N1 |
InChi: | InChI=1S/C13H12N2O2/c16-13(17)11-6-9-5-8-3-1-2-4-10(8)14-7-12(9)15-11/h1-4,6,14-15H,5,7H2,(H,16,17) |
InChiKey: | InChIKey=FWTIFOFBGYSCQN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.