* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX145044-001 |
| EnglishSynonyms: | WUXIAPPTEC WX145044-005 ; WUXIAPPTEC WX145044-001 ; WUXIAPPTEC WX145044-010 |
| pro_mdlNumber: | MFCD17016941 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | BrC1=CC=C2CNS(=O)(=O)C3=CC=CC=C3N12 |
| InChi: | InChI=1S/C11H9BrN2O2S/c12-11-6-5-8-7-13-17(15,16)10-4-2-1-3-9(10)14(8)11/h1-6,13H,7H2 |
| InChiKey: | InChIKey=ZMKPIIMTCJMMAU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.