* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX145045-001 |
| EnglishSynonyms: | WUXIAPPTEC WX145045-010 ; WUXIAPPTEC WX145045-001 ; WUXIAPPTEC WX145045-005 |
| pro_mdlNumber: | MFCD17016942 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | OC(=O)C1=CC=C2CNS(=O)(=O)C3=CC=CC=C3N12 |
| InChi: | InChI=1S/C12H10N2O4S/c15-12(16)10-6-5-8-7-13-19(17,18)11-4-2-1-3-9(11)14(8)10/h1-6,13H,7H2,(H,15,16) |
| InChiKey: | InChIKey=FNIBQASGDKREJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.