* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX145050-001 |
| EnglishSynonyms: | WUXIAPPTEC WX145050-001 ; WUXIAPPTEC WX145050-010 ; WUXIAPPTEC WX145050-005 |
| pro_mdlNumber: | MFCD17016944 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | BrC1=C2CNS(=O)(=O)C3=CC=CC=C3N2N=C1 |
| InChi: | InChI=1S/C10H8BrN3O2S/c11-7-5-12-14-8-3-1-2-4-10(8)17(15,16)13-6-9(7)14/h1-5,13H,6H2 |
| InChiKey: | InChIKey=SMQTYPDREPLUHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.