* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX145060-001 |
| EnglishSynonyms: | WUXIAPPTEC WX145060-005 ; WUXIAPPTEC WX145060-001 ; WUXIAPPTEC WX145060-010 |
| pro_mdlNumber: | MFCD17016951 |
| pro_acceptors: | 6 |
| pro_donors: | 0 |
| pro_smile: | BrC1=CN2N=C3CN(CCC3=C2N=C1)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C17H15BrN4O2/c18-13-8-19-16-14-6-7-21(10-15(14)20-22(16)9-13)17(23)24-11-12-4-2-1-3-5-12/h1-5,8-9H,6-7,10-11H2 |
| InChiKey: | InChIKey=XVZFJHYFUBYCOC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.