* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX145061-001 |
| EnglishSynonyms: | WUXIAPPTEC WX145061-010 ; WUXIAPPTEC WX145061-005 ; WUXIAPPTEC WX145061-001 |
| pro_mdlNumber: | MFCD17016952 |
| pro_acceptors: | 7 |
| pro_donors: | 0 |
| pro_smile: | ClC1=NC=NC2=C3CCN(CC3=NN12)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C16H14ClN5O2/c17-15-19-10-18-14-12-6-7-21(8-13(12)20-22(14)15)16(23)24-9-11-4-2-1-3-5-11/h1-5,10H,6-9H2 |
| InChiKey: | InChIKey=LQIADUXGTAMFOU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.