* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX145063-001 |
EnglishSynonyms: | WUXIAPPTEC WX145063-005 ; WUXIAPPTEC WX145063-010 ; WUXIAPPTEC WX145063-001 |
pro_mdlNumber: | MFCD17016954 |
pro_acceptors: | 6 |
pro_donors: | 1 |
pro_smile: | BrC1=CNC2=C3CCN(CC3=NN12)C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C16H15BrN4O2/c17-14-8-18-15-12-6-7-20(9-13(12)19-21(14)15)16(22)23-10-11-4-2-1-3-5-11/h1-5,8,18H,6-7,9-10H2 |
InChiKey: | InChIKey=BXORURVHCSCZSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.