* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX145064-001 |
EnglishSynonyms: | WUXIAPPTEC WX145064-005 ; WUXIAPPTEC WX145064-010 ; WUXIAPPTEC WX145064-001 |
pro_mdlNumber: | MFCD17016955 |
pro_acceptors: | 6 |
pro_donors: | 0 |
pro_smile: | ClC1=NC2=C3CCN(CC3=NN2C(Cl)=C1)C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C17H14Cl2N4O2/c18-14-8-15(19)23-16(20-14)12-6-7-22(9-13(12)21-23)17(24)25-10-11-4-2-1-3-5-11/h1-5,8H,6-7,9-10H2 |
InChiKey: | InChIKey=NZNSLOTZZNAREC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.