* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX145069-001 |
EnglishSynonyms: | WUXIAPPTEC WX145069-001 ; WUXIAPPTEC WX145069-005 ; WUXIAPPTEC WX145069-010 |
pro_mdlNumber: | MFCD17016960 |
pro_acceptors: | 6 |
pro_donors: | 0 |
pro_smile: | CC(C)(C)OC(=O)N1CCC2=C(C1)SC1=NN=C(Br)N21 |
InChi: | InChI=1S/C12H15BrN4O2S/c1-12(2,3)19-11(18)16-5-4-7-8(6-16)20-10-15-14-9(13)17(7)10/h4-6H2,1-3H3 |
InChiKey: | InChIKey=ZRRIEXMDAZJRFW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.