* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX145081-001 |
EnglishSynonyms: | WUXIAPPTEC WX145081-001 ; WUXIAPPTEC WX145081-010 ; WUXIAPPTEC WX145081-005 |
pro_mdlNumber: | MFCD17016971 |
pro_acceptors: | 6 |
pro_donors: | 1 |
pro_smile: | CCOC(=O)C1=CN2C(=O)C3=C(CNCC3)N=C2C=C1 |
InChi: | InChI=1S/C14H15N3O3/c1-2-20-14(19)9-3-4-12-16-11-7-15-6-5-10(11)13(18)17(12)8-9/h3-4,8,15H,2,5-7H2,1H3 |
InChiKey: | InChIKey=HVLAUOCMJALCQI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.