* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX145083-001 |
EnglishSynonyms: | WUXIAPPTEC WX145083-010 ; WUXIAPPTEC WX145083-005 ; WUXIAPPTEC WX145083-001 |
pro_mdlNumber: | MFCD17016973 |
pro_acceptors: | 7 |
pro_donors: | 0 |
pro_smile: | ClC1=C2CCN(CC2=NC2=NN=CN12)C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C16H14ClN5O2/c17-14-12-6-7-21(8-13(12)19-15-20-18-10-22(14)15)16(23)24-9-11-4-2-1-3-5-11/h1-5,10H,6-9H2 |
InChiKey: | InChIKey=GWLMPOFKXCZRDE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.