* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX145086-001 |
EnglishSynonyms: | WUXIAPPTEC WX145086-010 ; WUXIAPPTEC WX145086-005 ; WUXIAPPTEC WX145086-001 |
pro_mdlNumber: | MFCD17016976 |
pro_acceptors: | 8 |
pro_donors: | 1 |
pro_smile: | CCOC(=O)C1=NN=C2CCN3C=NC(N)=C3CN12 |
InChi: | InChI=1S/C11H14N6O2/c1-2-19-11(18)10-15-14-8-3-4-16-6-13-9(12)7(16)5-17(8)10/h6H,2-5,12H2,1H3 |
InChiKey: | InChIKey=ATOWWYCVOHHXNZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.