* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX145088-001 |
| EnglishSynonyms: | WUXIAPPTEC WX145088-005 ; WUXIAPPTEC WX145088-001 ; WUXIAPPTEC WX145088-010 |
| pro_mdlNumber: | MFCD17016978 |
| pro_acceptors: | 8 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)C1=C2CN3C(N)=NN=C3CCN2C=N1 |
| InChi: | InChI=1S/C11H14N6O2/c1-2-19-10(18)9-7-5-17-8(14-15-11(17)12)3-4-16(7)6-13-9/h6H,2-5H2,1H3,(H2,12,15) |
| InChiKey: | InChIKey=DDLPASHQRDCDDP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.