* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX155018-001 |
| EnglishSynonyms: | WUXIAPPTEC WX155018-001 ; WUXIAPPTEC WX155018-010 ; WUXIAPPTEC WX155018-005 |
| pro_mdlNumber: | MFCD17016987 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | BrC1=CN=C(S1)C1=NOC2=C1C=C(Br)C=C2 |
| InChi: | InChI=1S/C10H4Br2N2OS/c11-5-1-2-7-6(3-5)9(14-15-7)10-13-4-8(12)16-10/h1-4H |
| InChiKey: | InChIKey=NRBVRFLQZMIPEG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.