* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX155025-001 |
EnglishSynonyms: | WUXIAPPTEC WX155025-005 ; WUXIAPPTEC WX155025-001 ; WUXIAPPTEC WX155025-010 |
pro_mdlNumber: | MFCD17016994 |
pro_acceptors: | 7 |
pro_donors: | 1 |
pro_smile: | OC(=O)C1=CC=C(O1)C1=NN=C2N1C=CN=C2Cl |
InChi: | InChI=1S/C10H5ClN4O3/c11-7-9-14-13-8(15(9)4-3-12-7)5-1-2-6(18-5)10(16)17/h1-4H,(H,16,17) |
InChiKey: | InChIKey=IKITZNXNMDBTME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.