* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX155026-001 |
EnglishSynonyms: | WUXIAPPTEC WX155026-010 ; WUXIAPPTEC WX155026-001 ; WUXIAPPTEC WX155026-005 |
pro_mdlNumber: | MFCD17016995 |
pro_acceptors: | 8 |
pro_donors: | 2 |
pro_smile: | OC(=O)C1=C(NC=N1)C1=NN=C2C=NC(Cl)=CN12 |
InChi: | InChI=1S/C9H5ClN6O2/c10-4-2-16-5(1-11-4)14-15-8(16)6-7(9(17)18)13-3-12-6/h1-3H,(H,12,13)(H,17,18) |
InChiKey: | InChIKey=IYXBXRVUCJUXEJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.