* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX155031-001 |
| EnglishSynonyms: | WUXIAPPTEC WX155031-005 ; WUXIAPPTEC WX155031-010 ; WUXIAPPTEC WX155031-001 |
| pro_mdlNumber: | MFCD17016999 |
| pro_acceptors: | 7 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)C1=NC(N2C=NC(N)=C2)=C2C=CC=CN12 |
| InChi: | InChI=1S/C13H13N5O2/c1-2-20-13(19)12-16-11(17-7-10(14)15-8-17)9-5-3-4-6-18(9)12/h3-8H,2,14H2,1H3 |
| InChiKey: | InChIKey=HHUPZEKEVPGNLB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.