* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX155032-001 |
| EnglishSynonyms: | WUXIAPPTEC WX155032-010 ; WUXIAPPTEC WX155032-001 ; WUXIAPPTEC WX155032-005 |
| pro_mdlNumber: | MFCD17017000 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)C1=C2C=CC=CN2C(=N1)C1=CN=CN1 |
| InChi: | InChI=1S/C13H12N4O2/c1-2-19-13(18)11-10-5-3-4-6-17(10)12(16-11)9-7-14-8-15-9/h3-8H,2H2,1H3,(H,14,15) |
| InChiKey: | InChIKey=VQSCQCUHLVKEMG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.