* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX155033-001 |
| EnglishSynonyms: | WUXIAPPTEC WX155033-005 ; WUXIAPPTEC WX155033-001 ; WUXIAPPTEC WX155033-010 |
| pro_mdlNumber: | MFCD17017001 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | CCOC(=O)C1=CC=C2N=C(NC2=C1)C1=CNN=C1 |
| InChi: | InChI=1S/C13H12N4O2/c1-2-19-13(18)8-3-4-10-11(5-8)17-12(16-10)9-6-14-15-7-9/h3-7H,2H2,1H3,(H,14,15)(H,16,17) |
| InChiKey: | InChIKey=OMSLGNMUVZKSKN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.