* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX165021-001 |
| EnglishSynonyms: | WUXIAPPTEC WX165021-001 ; WUXIAPPTEC WX165021-010 ; WUXIAPPTEC WX165021-005 |
| pro_mdlNumber: | MFCD17017010 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | BrC1=CC(=NC2=CC=CC=C12)C1CNCCO1 |
| InChi: | InChI=1S/C13H13BrN2O/c14-10-7-12(13-8-15-5-6-17-13)16-11-4-2-1-3-9(10)11/h1-4,7,13,15H,5-6,8H2 |
| InChiKey: | InChIKey=KOMYBVRRGHMONS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.