* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX165037-001 |
| EnglishSynonyms: | WUXIAPPTEC WX165037-010 ; WUXIAPPTEC WX165037-005 ; WUXIAPPTEC WX165037-001 |
| pro_mdlNumber: | MFCD17017026 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | OC(=O)C1=CC=C(N1)C1CCOC2=C1C=CC=C2 |
| InChi: | InChI=1S/C14H13NO3/c16-14(17)12-6-5-11(15-12)9-7-8-18-13-4-2-1-3-10(9)13/h1-6,9,15H,7-8H2,(H,16,17) |
| InChiKey: | InChIKey=GXMNQUIXZRLUMD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.