* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX165042-001 |
EnglishSynonyms: | WUXIAPPTEC WX165042-010 ; WUXIAPPTEC WX165042-001 ; WUXIAPPTEC WX165042-005 |
pro_mdlNumber: | MFCD17017028 |
pro_acceptors: | 3 |
pro_donors: | 1 |
pro_smile: | BrC1=C(N=C2C=CC=CN12)C1CCCNC1 |
InChi: | InChI=1S/C12H14BrN3/c13-12-11(9-4-3-6-14-8-9)15-10-5-1-2-7-16(10)12/h1-2,5,7,9,14H,3-4,6,8H2 |
InChiKey: | InChIKey=UGVHGCGLZUDYCL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.