* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX165073-001 |
EnglishSynonyms: | WUXIAPPTEC WX165073-001 ; WUXIAPPTEC WX165073-005 ; WUXIAPPTEC WX165073-010 |
pro_mdlNumber: | MFCD17017055 |
pro_acceptors: | 5 |
pro_donors: | 2 |
pro_smile: | BrC1=CN2C(C=C1)=NN=C2C1CNCCN1 |
InChi: | InChI=1S/C10H12BrN5/c11-7-1-2-9-14-15-10(16(9)6-7)8-5-12-3-4-13-8/h1-2,6,8,12-13H,3-5H2 |
InChiKey: | InChIKey=TVAXTGQWOINERM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.