* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX165075-001 |
| EnglishSynonyms: | WUXIAPPTEC WX165075-005 ; WUXIAPPTEC WX165075-001 ; WUXIAPPTEC WX165075-010 |
| pro_mdlNumber: | MFCD17017057 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | BrC1=CN2N=C(N=C2C=C1)C1CCCCN1 |
| InChi: | InChI=1S/C11H13BrN4/c12-8-4-5-10-14-11(15-16(10)7-8)9-3-1-2-6-13-9/h4-5,7,9,13H,1-3,6H2 |
| InChiKey: | InChIKey=NFWUTTKNMPXOGU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.