* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX170023-001 |
EnglishSynonyms: | WUXIAPPTEC WX170023-005 ; WUXIAPPTEC WX170023-001 ; WUXIAPPTEC WX170023-010 |
pro_mdlNumber: | MFCD17017063 |
pro_acceptors: | 8 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC[C@@H](C2CCN(CC2)C(=O)OCC2=CC=CC=C2)[C@@H](C1)C(O)=O |
InChi: | InChI=1S/C24H34N2O6/c1-24(2,3)32-23(30)26-14-11-19(20(15-26)21(27)28)18-9-12-25(13-10-18)22(29)31-16-17-7-5-4-6-8-17/h4-8,18-20H,9-16H2,1-3H3,(H,27,28)/t19-,20+/m0/s1 |
InChiKey: | InChIKey=AXNHKGOURQOTLX-VQTJNVASSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.