* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX170024-001 |
| EnglishSynonyms: | WUXIAPPTEC WX170024-010 ; WUXIAPPTEC WX170024-005 ; WUXIAPPTEC WX170024-001 |
| pro_mdlNumber: | MFCD17017064 |
| pro_acceptors: | 8 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)C(O)=O)C1CCN(CC1)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C23H32N2O6/c1-23(2,3)31-22(29)25-13-18(19(14-25)20(26)27)17-9-11-24(12-10-17)21(28)30-15-16-7-5-4-6-8-16/h4-8,17-19H,9-15H2,1-3H3,(H,26,27)/t18-,19+/m0/s1 |
| InChiKey: | InChIKey=NEEYVEXKDXDRRT-RBUKOAKNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.