* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX170026-001 |
| EnglishSynonyms: | WUXIAPPTEC WX170026-005 ; WUXIAPPTEC WX170026-001 ; WUXIAPPTEC WX170026-010 |
| pro_mdlNumber: | MFCD17017066 |
| pro_acceptors: | 7 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1C[C@@H](N)[C@@H](C1)C1CCN(CC1)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C22H33N3O4/c1-22(2,3)29-21(27)25-13-18(19(23)14-25)17-9-11-24(12-10-17)20(26)28-15-16-7-5-4-6-8-16/h4-8,17-19H,9-15,23H2,1-3H3/t18-,19+/m0/s1 |
| InChiKey: | InChIKey=BBRNWULUJQRGSV-RBUKOAKNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.