* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX175018-001 |
| EnglishSynonyms: | WUXIAPPTEC WX175018-010 ; WUXIAPPTEC WX175018-001 ; WUXIAPPTEC WX175018-005 |
| pro_mdlNumber: | MFCD17017080 |
| pro_acceptors: | 7 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)OC(=O)NC1CCN(CC1)C1COC2=C1C=C(C=C2)C(O)=O |
| InChi: | InChI=1S/C19H26N2O5/c1-19(2,3)26-18(24)20-13-6-8-21(9-7-13)15-11-25-16-5-4-12(17(22)23)10-14(15)16/h4-5,10,13,15H,6-9,11H2,1-3H3,(H,20,24)(H,22,23) |
| InChiKey: | InChIKey=WALXYINTXRXLKB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.