* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX175020-001 |
| EnglishSynonyms: | WUXIAPPTEC WX175020-005 ; WUXIAPPTEC WX175020-001 ; WUXIAPPTEC WX175020-010 |
| pro_mdlNumber: | MFCD17017082 |
| pro_acceptors: | 7 |
| pro_donors: | 0 |
| pro_smile: | COC(=O)C1CCCN1C1COC2=C(C=CC=C2)N(C1)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C20H28N2O5/c1-20(2,3)27-19(24)22-12-14(13-26-17-10-6-5-8-15(17)22)21-11-7-9-16(21)18(23)25-4/h5-6,8,10,14,16H,7,9,11-13H2,1-4H3 |
| InChiKey: | InChIKey=ODPLOKIXSRMVJL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.