* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX175022-001 |
| EnglishSynonyms: | WUXIAPPTEC WX175022-005 ; WUXIAPPTEC WX175022-010 ; WUXIAPPTEC WX175022-001 |
| pro_mdlNumber: | MFCD17017084 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | O=C(OCC1=CC=CC=C1)N1CCCC(C1)C1CCNC2C=CC=CC12 |
| InChi: | InChI=1S/C22H28N2O2/c25-22(26-16-17-7-2-1-3-8-17)24-14-6-9-18(15-24)19-12-13-23-21-11-5-4-10-20(19)21/h1-5,7-8,10-11,18-21,23H,6,9,12-16H2 |
| InChiKey: | InChIKey=KHXBIVNXZWCRMF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.