* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX175023-001 |
| EnglishSynonyms: | WUXIAPPTEC WX175023-005 ; WUXIAPPTEC WX175023-001 ; WUXIAPPTEC WX175023-010 |
| pro_mdlNumber: | MFCD17017085 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)OC(=O)N1CCCC(C2CCCCN2)C2=C1C=CC=C2 |
| InChi: | InChI=1S/C20H30N2O2/c1-20(2,3)24-19(23)22-14-8-10-15(17-11-6-7-13-21-17)16-9-4-5-12-18(16)22/h4-5,9,12,15,17,21H,6-8,10-11,13-14H2,1-3H3 |
| InChiKey: | InChIKey=QHOIFGOAYSLTMK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.