* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX175025-001 |
EnglishSynonyms: | WUXIAPPTEC WX175025-010 ; WUXIAPPTEC WX175025-005 ; WUXIAPPTEC WX175025-001 |
pro_mdlNumber: | MFCD17017087 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CCOC(C1)C1CC2=CC=CC=C2CN1 |
InChi: | InChI=1S/C18H26N2O3/c1-18(2,3)23-17(21)20-8-9-22-16(12-20)15-10-13-6-4-5-7-14(13)11-19-15/h4-7,15-16,19H,8-12H2,1-3H3 |
InChiKey: | InChIKey=MOMOWANKPIRWFX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.