* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX175027-001 |
EnglishSynonyms: | WUXIAPPTEC WX175027-010 ; WUXIAPPTEC WX175027-005 ; WUXIAPPTEC WX175027-001 |
pro_mdlNumber: | MFCD17017089 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | C1COCC(N1)C1CCNC2=CC=CC=C12 |
InChi: | InChI=1S/C13H18N2O/c1-2-4-12-10(3-1)11(5-6-14-12)13-9-16-8-7-15-13/h1-4,11,13-15H,5-9H2 |
InChiKey: | InChIKey=MHTCHEDSDVEUHN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.