* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX175041-001 |
EnglishSynonyms: | WUXIAPPTEC WX175041-005 ; WUXIAPPTEC WX175041-001 ; WUXIAPPTEC WX175041-010 |
pro_mdlNumber: | MFCD17017100 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CC(C1)C1(COCCCN1)C1=CC=CC=C1 |
InChi: | InChI=1S/C19H28N2O3/c1-18(2,3)24-17(22)21-12-16(13-21)19(14-23-11-7-10-20-19)15-8-5-4-6-9-15/h4-6,8-9,16,20H,7,10-14H2,1-3H3 |
InChiKey: | InChIKey=AKVSWTLPXNRZRY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.