* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WUXIAPPTEC WX105356-001 |
EnglishSynonyms: | WUXIAPPTEC WX105356-001 ; WUXIAPPTEC WX105356-005 ; WUXIAPPTEC WX105356-010 |
pro_mdlNumber: | MFCD17017107 |
pro_acceptors: | 8 |
pro_donors: | 0 |
pro_smile: | CCOC(=O)C1=CN2CC3(CCN(C3)C(=O)OC(C)(C)C)CC2=NC1=O |
InChi: | InChI=1S/C18H25N3O5/c1-5-25-15(23)12-9-21-11-18(8-13(21)19-14(12)22)6-7-20(10-18)16(24)26-17(2,3)4/h9H,5-8,10-11H2,1-4H3 |
InChiKey: | InChIKey=WKWNNQWOTAKEEI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.