* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX115195-001 |
| EnglishSynonyms: | WUXIAPPTEC WX115195-005 ; WUXIAPPTEC WX115195-001 ; WUXIAPPTEC WX115195-010 |
| pro_mdlNumber: | MFCD17017117 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | BrC1=NC2=C(CNCC3=C2C=CC=C3)S1 |
| InChi: | InChI=1S/C11H9BrN2S/c12-11-14-10-8-4-2-1-3-7(8)5-13-6-9(10)15-11/h1-4,13H,5-6H2 |
| InChiKey: | InChIKey=AHVSNYXGIWXPGX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.