* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX165083-001 |
| EnglishSynonyms: | WUXIAPPTEC WX165083-005 ; WUXIAPPTEC WX165083-001 ; WUXIAPPTEC WX165083-010 |
| pro_mdlNumber: | MFCD17017123 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | BrC1=CN2C=NC(C3CNCCO3)=C2C=C1 |
| InChi: | InChI=1S/C11H12BrN3O/c12-8-1-2-9-11(14-7-15(9)6-8)10-5-13-3-4-16-10/h1-2,6-7,10,13H,3-5H2 |
| InChiKey: | InChIKey=WBZZVQRYMCZDQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.