* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX165084-001 |
| EnglishSynonyms: | WUXIAPPTEC WX165084-001 ; WUXIAPPTEC WX165084-010 ; WUXIAPPTEC WX165084-005 |
| pro_mdlNumber: | MFCD17017124 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | OC(=O)C1=C2C=CC=CN2C(=N1)C1CCCN1 |
| InChi: | InChI=1S/C12H13N3O2/c16-12(17)10-9-5-1-2-7-15(9)11(14-10)8-4-3-6-13-8/h1-2,5,7-8,13H,3-4,6H2,(H,16,17) |
| InChiKey: | InChIKey=VJRQRUQLWXJVOP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.