* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | WUXIAPPTEC WX165087-001 |
| EnglishSynonyms: | WUXIAPPTEC WX165087-001 ; WUXIAPPTEC WX165087-005 ; WUXIAPPTEC WX165087-010 |
| pro_mdlNumber: | MFCD17017127 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | NCC1=C2C=CC=CN2C(=N1)C1CCNCC1 |
| InChi: | InChI=1S/C13H18N4/c14-9-11-12-3-1-2-8-17(12)13(16-11)10-4-6-15-7-5-10/h1-3,8,10,15H,4-7,9,14H2 |
| InChiKey: | InChIKey=YEUKMOFSVVAHCM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.